C23H31N3O4Si — CID 91517481
(3S,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxyoxan-4-ol (PubChem CID 91517481) has the molecular formula C23H31N3O4Si and a molecular weight of 441.60 g/mol. Its IUPAC name is (3S,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxyoxan-4-ol.
| Compound Name | (3S,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxyoxan-4-ol |
|---|---|
| PubChem CID | 91517481 |
| Molecular Formula | C23H31N3O4Si |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (3S,4R)-5-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methoxyoxan-4-ol |
| SMILES | CO[C@@H]1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCC(N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C23H31N3O4Si/c1-23(2,3)31(17-11-7-5-8-12-17,18-13-9-6-10-14-18)30-16-20-22(28-4)21(27)19(15-29-20)25-26-24/h5-14,19-22,27H,15-16H2,1-4H3/t19?,20?,21-,22-/m1/s1 |
| InChIKey | OTSOKSNNVLZGSM-LIKPIUCQSA-N |
| XLogP | 3.02 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|