C23H32N4O3SSi — CID 58400098
(3R,4R,6S)-5-amino-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylsulfanyloxan-4-ol (PubChem CID 58400098) has the molecular formula C23H32N4O3SSi and a molecular weight of 472.69 g/mol. Its IUPAC name is (3R,4R,6S)-5-amino-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylsulfanyloxan-4-ol.
| Compound Name | (3R,4R,6S)-5-amino-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylsulfanyloxan-4-ol |
|---|---|
| PubChem CID | 58400098 |
| Molecular Formula | C23H32N4O3SSi |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | (3R,4R,6S)-5-amino-3-azido-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylsulfanyloxan-4-ol |
| SMILES | CS[C@@H]1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](N=[N+]=[N-])[C@H](O)C1N |
| InChI | InChI=1S/C23H32N4O3SSi/c1-23(2,3)32(16-11-7-5-8-12-16,17-13-9-6-10-14-17)29-15-18-20(26-27-25)21(28)19(24)22(30-18)31-4/h5-14,18-22,28H,15,24H2,1-4H3/t18?,19?,20-,21+,22-/m0/s1 |
| InChIKey | MOXFFNFXYYMIKD-ZHMMRPBMSA-N |
| XLogP | 3.02 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|