C24H33NO5Si — CID 101010470
N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]hydroxylamine (PubChem CID 101010470) has the molecular formula C24H33NO5Si and a molecular weight of 443.62 g/mol. Its IUPAC name is N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]hydroxylamine.
| Compound Name | N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]hydroxylamine |
|---|---|
| PubChem CID | 101010470 |
| Molecular Formula | C24H33NO5Si |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]hydroxylamine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[C@H]2NO |
| InChI | InChI=1S/C24H33NO5Si/c1-23(2,3)31(17-12-8-6-9-13-17,18-14-10-7-11-15-18)27-16-19-20-21(22(25-26)28-19)30-24(4,5)29-20/h6-15,19-22,25-26H,16H2,1-5H3/t19-,20-,21-,22-/m1/s1 |
| InChIKey | KWDOCVKJAKPALL-GXRSIYKFSA-N |
| XLogP | 2.79 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|