C28H39NO6Si — CID 169312399
[(5S)-2-[(3aS,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidin-5-yl]methanol (PubChem CID 169312399) has the molecular formula C28H39NO6Si and a molecular weight of 513.71 g/mol. Its IUPAC name is [(5S)-2-[(3aS,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidin-5-yl]methanol.
| Compound Name | [(5S)-2-[(3aS,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidin-5-yl]methanol |
|---|---|
| PubChem CID | 169312399 |
| Molecular Formula | C28H39NO6Si |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [(5S)-2-[(3aS,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2-oxazolidin-5-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](N1CC[C@@H](CO)O1)O[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H39NO6Si/c1-27(2,3)36(21-12-8-6-9-13-21,22-14-10-7-11-15-22)31-19-23-24-25(34-28(4,5)33-24)26(32-23)29-17-16-20(18-30)35-29/h6-15,20,23-26,30H,16-19H2,1-5H3/t20-,23+,24-,25-,26+/m0/s1 |
| InChIKey | QTDGAQNNAJLCGQ-APYQXVPZSA-N |
| XLogP | 2.81 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|