C28H37NO7Si — CID 11307054
N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-ethoxy-2-oxoethanimine oxide (PubChem CID 11307054) has the molecular formula C28H37NO7Si and a molecular weight of 527.69 g/mol. Its IUPAC name is N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-ethoxy-2-oxoethanimine oxide.
| Compound Name | N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-ethoxy-2-oxoethanimine oxide |
|---|---|
| PubChem CID | 11307054 |
| Molecular Formula | C28H37NO7Si |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | N-[(3aR,4R,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-2-ethoxy-2-oxoethanimine oxide |
| SMILES | CCOC(=O)/C=[N+](/[O-])[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C28H37NO7Si/c1-7-32-23(30)18-29(31)26-25-24(35-28(5,6)36-25)22(34-26)19-33-37(27(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-18,22,24-26H,7,19H2,1-6H3/b29-18+/t22-,24-,25-,26-/m1/s1 |
| InChIKey | BEKJQMUDAYRHQJ-WLADZFDOSA-N |
| XLogP | 2.95 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|