C27H35N3O6Si — CID 176778018
[(3aS,6R,7aS)-6-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 176778018) has the molecular formula C27H35N3O6Si and a molecular weight of 525.68 g/mol. Its IUPAC name is [(3aS,6R,7aS)-6-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(3aS,6R,7aS)-6-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 176778018 |
| Molecular Formula | C27H35N3O6Si |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | [(3aS,6R,7aS)-6-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CC(=O)OC1[C@H](N=[N+]=[N-])OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C27H35N3O6Si/c1-18(31)33-24-23-22(35-27(5,6)36-23)21(34-25(24)29-30-28)17-32-37(26(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21-25H,17H2,1-6H3/t21?,22-,23-,24?,25+/m0/s1 |
| InChIKey | SKNGHEXLAGVFHX-ITQBYMJOSA-N |
| XLogP | 4.05 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|