C24H29N3O5Si — CID 131739957
[(1R,2S,3R,4R,5R)-4-azido-5-diphenylsilyl-2-[(2-methylpropan-2-yl)oxy]-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate (PubChem CID 131739957) has the molecular formula C24H29N3O5Si and a molecular weight of 467.60 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-4-azido-5-diphenylsilyl-2-[(2-methylpropan-2-yl)oxy]-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate.
| Compound Name | [(1R,2S,3R,4R,5R)-4-azido-5-diphenylsilyl-2-[(2-methylpropan-2-yl)oxy]-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
|---|---|
| PubChem CID | 131739957 |
| Molecular Formula | C24H29N3O5Si |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-4-azido-5-diphenylsilyl-2-[(2-methylpropan-2-yl)oxy]-6,8-dioxabicyclo[3.2.1]octan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)(C)C)[C@H]2CO[C@@]([SiH](c3ccccc3)c3ccccc3)(O2)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C24H29N3O5Si/c1-16(28)30-21-20(32-23(2,3)4)19-15-29-24(31-19,22(21)26-27-25)33(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-22,33H,15H2,1-4H3/t19-,20-,21+,22-,24-/m1/s1 |
| InChIKey | XHKCMTMNBGXGOO-WKKMNAASSA-N |
| XLogP | 2.49 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|