C31H47NO5Si — CID 57181503
[(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] 2,2-dimethylpropanoate (PubChem CID 57181503) has the molecular formula C31H47NO5Si and a molecular weight of 541.81 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57181503 |
| Molecular Formula | C31H47NO5Si |
| Molecular Weight | 541.81 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | [(3S,4S,5R,6R)-1-butyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4,5-dihydroxypiperidin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CCCCN1C[C@H](OC(=O)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H47NO5Si/c1-8-9-20-32-21-26(37-29(35)30(2,3)4)28(34)27(33)25(32)22-36-38(31(5,6)7,23-16-12-10-13-17-23)24-18-14-11-15-19-24/h10-19,25-28,33-34H,8-9,20-22H2,1-7H3/t25-,26+,27-,28-/m1/s1 |
| InChIKey | KVJQZCZUZYPYIN-JUDWXZBOSA-N |
| XLogP | 3.73 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|