C26H39NO4Si — CID 22856139
(2R,3R,4R,5S)-1-butyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidine-3,4,5-triol (PubChem CID 22856139) has the molecular formula C26H39NO4Si and a molecular weight of 457.69 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-butyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-butyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 22856139 |
| Molecular Formula | C26H39NO4Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (2R,3R,4R,5S)-1-butyl-2-[[tert-butyl(diphenyl)silyl]oxymethyl]piperidine-3,4,5-triol |
| SMILES | CCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H39NO4Si/c1-5-6-17-27-18-23(28)25(30)24(29)22(27)19-31-32(26(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,22-25,28-30H,5-6,17-19H2,1-4H3/t22-,23+,24-,25-/m1/s1 |
| InChIKey | ZMYBMLIOHWZMCY-ZFFYZDHPSA-N |
| XLogP | 2.13 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|