C38H63NOSiSn — CID 85111638
tert-butyl-[[3-cyclohexyl-1-(tributylstannylmethyl)aziridin-2-yl]methoxy]-diphenylsilane (PubChem CID 85111638) has the molecular formula C38H63NOSiSn and a molecular weight of 696.73 g/mol. Its IUPAC name is tert-butyl-[[3-cyclohexyl-1-(tributylstannylmethyl)aziridin-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[3-cyclohexyl-1-(tributylstannylmethyl)aziridin-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 85111638 |
| Molecular Formula | C38H63NOSiSn |
| Molecular Weight | 696.73 g/mol |
| Exact Mass | 697.37 |
| IUPAC Name | tert-butyl-[[3-cyclohexyl-1-(tributylstannylmethyl)aziridin-2-yl]methoxy]-diphenylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CN1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1C1CCCCC1 |
| InChI | InChI=1S/C26H36NOSi.3C4H9.Sn/c1-26(2,3)29(22-16-10-6-11-17-22,23-18-12-7-13-19-23)28-20-24-25(27(24)4)21-14-8-5-9-15-21;3*1-3-4-2;/h6-7,10-13,16-19,21,24-25H,4-5,8-9,14-15,20H2,1-3H3;3*1,3-4H2,2H3; |
| InChIKey | FPFGZRCIESKDCV-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.73 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|