C28H40O4Si — CID 122396895
(1S)-1-[(1R,3R,4aR,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromen-1-yl]ethane-1,2-diol (PubChem CID 122396895) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is (1S)-1-[(1R,3R,4aR,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromen-1-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(1R,3R,4aR,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromen-1-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 122396895 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (1S)-1-[(1R,3R,4aR,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-isochromen-1-yl]ethane-1,2-diol |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@H]2CCCC[C@@H]2[C@H]([C@@H](O)CO)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H40O4Si/c1-28(2,3)33(23-13-6-4-7-14-23,24-15-8-5-9-16-24)31-20-22-18-21-12-10-11-17-25(21)27(32-22)26(30)19-29/h4-9,13-16,21-22,25-27,29-30H,10-12,17-20H2,1-3H3/t21-,22-,25+,26+,27-/m1/s1 |
| InChIKey | LSSIORZVPXAFHV-KYJCGIAXSA-N |
| XLogP | 3.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|