C17H17NO2 — CID 97102711
(4R)-4-benzyl-1,3,4,5-tetrahydro-2,5-benzoxazocin-6-one (PubChem CID 97102711) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (4R)-4-benzyl-1,3,4,5-tetrahydro-2,5-benzoxazocin-6-one.
| Compound Name | (4R)-4-benzyl-1,3,4,5-tetrahydro-2,5-benzoxazocin-6-one |
|---|---|
| PubChem CID | 97102711 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (4R)-4-benzyl-1,3,4,5-tetrahydro-2,5-benzoxazocin-6-one |
| SMILES | O=C1N[C@H](Cc2ccccc2)COCc2ccccc21 |
| InChI | InChI=1S/C17H17NO2/c19-17-16-9-5-4-8-14(16)11-20-12-15(18-17)10-13-6-2-1-3-7-13/h1-9,15H,10-12H2,(H,18,19)/t15-/m1/s1 |
| InChIKey | WDZMWJMIWQDPGT-OAHLLOKOSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |