C24H28N2O5 — CID 155409492
N-benzyl-2-oxo-2-[(11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl]acetamide (PubChem CID 155409492) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-benzyl-2-oxo-2-[(11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl]acetamide.
| Compound Name | N-benzyl-2-oxo-2-[(11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl]acetamide |
|---|---|
| PubChem CID | 155409492 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-benzyl-2-oxo-2-[(11S)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl]acetamide |
| SMILES | O=C(NCc1ccccc1)C(=O)[C@@H]1CCCCOCCOCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C24H28N2O5/c27-22(24(29)25-16-18-8-2-1-3-9-18)21-12-6-7-13-30-14-15-31-17-19-10-4-5-11-20(19)23(28)26-21/h1-5,8-11,21H,6-7,12-17H2,(H,25,29)(H,26,28)/t21-/m0/s1 |
| InChIKey | FZUZIDLHOPIEFZ-NRFANRHFSA-N |
| XLogP | 2.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|