C35H42N4O5 — CID 155998874
(11S,16S)-N,11-dibenzyl-9-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide (PubChem CID 155998874) has the molecular formula C35H42N4O5 and a molecular weight of 598.74 g/mol. Its IUPAC name is (11S,16S)-N,11-dibenzyl-9-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide.
| Compound Name | (11S,16S)-N,11-dibenzyl-9-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide |
|---|---|
| PubChem CID | 155998874 |
| Molecular Formula | C35H42N4O5 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | (11S,16S)-N,11-dibenzyl-9-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide |
| SMILES | CN1CCCCCCOc2ccccc2C(=O)N[C@H](C(=O)NCc2ccccc2)CCC(=O)N[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C35H42N4O5/c1-39-22-12-2-3-13-23-44-31-19-11-10-18-28(31)33(41)38-29(34(42)36-25-27-16-8-5-9-17-27)20-21-32(40)37-30(35(39)43)24-26-14-6-4-7-15-26/h4-11,14-19,29-30H,2-3,12-13,20-25H2,1H3,(H,36,42)(H,37,40)(H,38,41)/t29-,30-/m0/s1 |
| InChIKey | IYVDCOLFSNMYFI-KYJUHHDHSA-N |
| XLogP | 4.02 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |