C36H44N4O7 — CID 155998979
(11S,16S)-11-[(4-hydroxyphenyl)methyl]-N-[(4-methoxyphenyl)methyl]-9-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide (PubChem CID 155998979) has the molecular formula C36H44N4O7 and a molecular weight of 644.77 g/mol. Its IUPAC name is (11S,16S)-11-[(4-hydroxyphenyl)methyl]-N-[(4-methoxyphenyl)methyl]-9-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide.
| Compound Name | (11S,16S)-11-[(4-hydroxyphenyl)methyl]-N-[(4-methoxyphenyl)methyl]-9-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide |
|---|---|
| PubChem CID | 155998979 |
| Molecular Formula | C36H44N4O7 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | (11S,16S)-11-[(4-hydroxyphenyl)methyl]-N-[(4-methoxyphenyl)methyl]-9-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@H]2CCC(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)N(C)CCCCCCOc3ccccc3C(=O)N2)cc1 |
| InChI | InChI=1S/C36H44N4O7/c1-40-21-7-3-4-8-22-47-32-10-6-5-9-29(32)34(43)39-30(35(44)37-24-26-13-17-28(46-2)18-14-26)19-20-33(42)38-31(36(40)45)23-25-11-15-27(41)16-12-25/h5-6,9-18,30-31,41H,3-4,7-8,19-24H2,1-2H3,(H,37,44)(H,38,42)(H,39,43)/t30-,31-/m0/s1 |
| InChIKey | NXKPHUNZGKTOFH-CONSDPRKSA-N |
| XLogP | 3.73 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |