C36H44N4O6 — CID 155998963
(11S,16S)-11-benzyl-N-[(4-methoxyphenyl)methyl]-12-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide (PubChem CID 155998963) has the molecular formula C36H44N4O6 and a molecular weight of 628.77 g/mol. Its IUPAC name is (11S,16S)-11-benzyl-N-[(4-methoxyphenyl)methyl]-12-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide.
| Compound Name | (11S,16S)-11-benzyl-N-[(4-methoxyphenyl)methyl]-12-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide |
|---|---|
| PubChem CID | 155998963 |
| Molecular Formula | C36H44N4O6 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | (11S,16S)-11-benzyl-N-[(4-methoxyphenyl)methyl]-12-methyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@@H]2CCC(=O)N(C)[C@@H](Cc3ccccc3)C(=O)NCCCCCCOc3ccccc3C(=O)N2)cc1 |
| InChI | InChI=1S/C36H44N4O6/c1-40-31(24-26-12-6-5-7-13-26)36(44)37-22-10-3-4-11-23-46-32-15-9-8-14-29(32)34(42)39-30(20-21-33(40)41)35(43)38-25-27-16-18-28(45-2)19-17-27/h5-9,12-19,30-31H,3-4,10-11,20-25H2,1-2H3,(H,37,44)(H,38,43)(H,39,42)/t30-,31-/m0/s1 |
| InChIKey | QZXLTARWDQWSMN-CONSDPRKSA-N |
| XLogP | 4.03 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |