C34H40N4O7 — CID 133078821
(4R,12S)-4-benzyl-N-[2-(4-methoxyphenoxy)ethyl]-5,8-dimethyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide (PubChem CID 133078821) has the molecular formula C34H40N4O7 and a molecular weight of 616.72 g/mol. Its IUPAC name is (4R,12S)-4-benzyl-N-[2-(4-methoxyphenoxy)ethyl]-5,8-dimethyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide.
| Compound Name | (4R,12S)-4-benzyl-N-[2-(4-methoxyphenoxy)ethyl]-5,8-dimethyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
|---|---|
| PubChem CID | 133078821 |
| Molecular Formula | C34H40N4O7 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | (4R,12S)-4-benzyl-N-[2-(4-methoxyphenoxy)ethyl]-5,8-dimethyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)[C@@H]2CCC(=O)N(C)CC(=O)N(C)[C@H](Cc3ccccc3)COc3ccccc3C(=O)N2)cc1 |
| InChI | InChI=1S/C34H40N4O7/c1-37-22-32(40)38(2)25(21-24-9-5-4-6-10-24)23-45-30-12-8-7-11-28(30)33(41)36-29(17-18-31(37)39)34(42)35-19-20-44-27-15-13-26(43-3)14-16-27/h4-16,25,29H,17-23H2,1-3H3,(H,35,42)(H,36,41)/t25-,29+/m1/s1 |
| InChIKey | NOXSWSDKAOGECY-IRPSRAIASA-N |
| XLogP | 2.69 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|