C26H32N4O7 — CID 133076409
(7S,11S)-N-[2-(4-methoxyphenoxy)ethyl]-5,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133076409) has the molecular formula C26H32N4O7 and a molecular weight of 512.56 g/mol. Its IUPAC name is (7S,11S)-N-[2-(4-methoxyphenoxy)ethyl]-5,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-N-[2-(4-methoxyphenoxy)ethyl]-5,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133076409 |
| Molecular Formula | C26H32N4O7 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (7S,11S)-N-[2-(4-methoxyphenoxy)ethyl]-5,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)[C@@H]2CC(=O)N[C@@H](C)C(=O)N(C)CCOc3ccccc3C(=O)N2)cc1 |
| InChI | InChI=1S/C26H32N4O7/c1-17-26(34)30(2)13-15-37-22-7-5-4-6-20(22)24(32)29-21(16-23(31)28-17)25(33)27-12-14-36-19-10-8-18(35-3)9-11-19/h4-11,17,21H,12-16H2,1-3H3,(H,27,33)(H,28,31)(H,29,32)/t17-,21-/m0/s1 |
| InChIKey | IEIUXBIWVXLQCO-UWJYYQICSA-N |
| XLogP | 0.73 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|