C23H34N4O6 — CID 133078858
(7R,11S)-N-(2-ethoxyethyl)-5-methyl-6,9,13-trioxo-7-propan-2-yl-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133078858) has the molecular formula C23H34N4O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is (7R,11S)-N-(2-ethoxyethyl)-5-methyl-6,9,13-trioxo-7-propan-2-yl-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7R,11S)-N-(2-ethoxyethyl)-5-methyl-6,9,13-trioxo-7-propan-2-yl-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133078858 |
| Molecular Formula | C23H34N4O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (7R,11S)-N-(2-ethoxyethyl)-5-methyl-6,9,13-trioxo-7-propan-2-yl-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | CCOCCNC(=O)[C@@H]1CC(=O)N[C@H](C(C)C)C(=O)N(C)CCOc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C23H34N4O6/c1-5-32-12-10-24-22(30)17-14-19(28)26-20(15(2)3)23(31)27(4)11-13-33-18-9-7-6-8-16(18)21(29)25-17/h6-9,15,17,20H,5,10-14H2,1-4H3,(H,24,30)(H,25,29)(H,26,28)/t17-,20+/m0/s1 |
| InChIKey | FBNCCZFBTKJFRP-FXAWDEMLSA-N |
| XLogP | 0.32 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|