C21H30N4O6 — CID 133076680
(7S,11S)-N-(2-ethoxyethyl)-5,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133076680) has the molecular formula C21H30N4O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is (7S,11S)-N-(2-ethoxyethyl)-5,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-N-(2-ethoxyethyl)-5,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133076680 |
| Molecular Formula | C21H30N4O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (7S,11S)-N-(2-ethoxyethyl)-5,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | CCOCCNC(=O)[C@@H]1CC(=O)N[C@@H](C)C(=O)N(C)CCOc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C21H30N4O6/c1-4-30-11-9-22-20(28)16-13-18(26)23-14(2)21(29)25(3)10-12-31-17-8-6-5-7-15(17)19(27)24-16/h5-8,14,16H,4,9-13H2,1-3H3,(H,22,28)(H,23,26)(H,24,27)/t14-,16-/m0/s1 |
| InChIKey | GAPSYWYUZGBQKT-HOCLYGCPSA-N |
| XLogP | -0.32 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|