C33H38N4O7 — CID 133075212
(7S,11S)-7-benzyl-N-[2-(4-methoxyphenoxy)ethyl]-N,5-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133075212) has the molecular formula C33H38N4O7 and a molecular weight of 602.69 g/mol. Its IUPAC name is (7S,11S)-7-benzyl-N-[2-(4-methoxyphenoxy)ethyl]-N,5-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-7-benzyl-N-[2-(4-methoxyphenoxy)ethyl]-N,5-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133075212 |
| Molecular Formula | C33H38N4O7 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | (7S,11S)-7-benzyl-N-[2-(4-methoxyphenoxy)ethyl]-N,5-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | COc1ccc(OCCN(C)C(=O)[C@@H]2CC(=O)N[C@@H](Cc3ccccc3)C(=O)N(C)CCOc3ccccc3C(=O)N2)cc1 |
| InChI | InChI=1S/C33H38N4O7/c1-36(17-19-43-25-15-13-24(42-3)14-16-25)33(41)28-22-30(38)34-27(21-23-9-5-4-6-10-23)32(40)37(2)18-20-44-29-12-8-7-11-26(29)31(39)35-28/h4-16,27-28H,17-22H2,1-3H3,(H,34,38)(H,35,39)/t27-,28-/m0/s1 |
| InChIKey | QECUYTWJCVBKQM-NSOVKSMOSA-N |
| XLogP | 2.30 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |