C34H40N4O6 — CID 133077455
(7R,11S)-7-benzyl-5-ethyl-N-methyl-N-[2-(4-methylphenoxy)ethyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133077455) has the molecular formula C34H40N4O6 and a molecular weight of 600.72 g/mol. Its IUPAC name is (7R,11S)-7-benzyl-5-ethyl-N-methyl-N-[2-(4-methylphenoxy)ethyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7R,11S)-7-benzyl-5-ethyl-N-methyl-N-[2-(4-methylphenoxy)ethyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133077455 |
| Molecular Formula | C34H40N4O6 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | (7R,11S)-7-benzyl-5-ethyl-N-methyl-N-[2-(4-methylphenoxy)ethyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | CCN1CCOc2ccccc2C(=O)N[C@H](C(=O)N(C)CCOc2ccc(C)cc2)CC(=O)N[C@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C34H40N4O6/c1-4-38-19-21-44-30-13-9-8-12-27(30)32(40)36-29(33(41)37(3)18-20-43-26-16-14-24(2)15-17-26)23-31(39)35-28(34(38)42)22-25-10-6-5-7-11-25/h5-17,28-29H,4,18-23H2,1-3H3,(H,35,39)(H,36,40)/t28-,29+/m1/s1 |
| InChIKey | XSCCGZNZCZRUTK-WDYNHAJCSA-N |
| XLogP | 2.99 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |