C29H39N5O5 — CID 133076816
(7S,12S)-7-benzyl-N-[3-(dimethylamino)propyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide (PubChem CID 133076816) has the molecular formula C29H39N5O5 and a molecular weight of 537.66 g/mol. Its IUPAC name is (7S,12S)-7-benzyl-N-[3-(dimethylamino)propyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide.
| Compound Name | (7S,12S)-7-benzyl-N-[3-(dimethylamino)propyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
|---|---|
| PubChem CID | 133076816 |
| Molecular Formula | C29H39N5O5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | (7S,12S)-7-benzyl-N-[3-(dimethylamino)propyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
| SMILES | CN(C)CCCNC(=O)[C@@H]1CCC(=O)N[C@@H](Cc2ccccc2)C(=O)N(C)CCOc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C29H39N5O5/c1-33(2)17-9-16-30-28(37)23-14-15-26(35)31-24(20-21-10-5-4-6-11-21)29(38)34(3)18-19-39-25-13-8-7-12-22(25)27(36)32-23/h4-8,10-13,23-24H,9,14-20H2,1-3H3,(H,30,37)(H,31,35)(H,32,36)/t23-,24-/m0/s1 |
| InChIKey | MLLQURRDDPKOIQ-ZEQRLZLVSA-N |
| XLogP | 1.21 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|