C34H40N4O8 — CID 133076388
(7S,12S)-7-[(4-hydroxyphenyl)methyl]-N-[2-(2-methoxy-4-methylphenoxy)ethyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide (PubChem CID 133076388) has the molecular formula C34H40N4O8 and a molecular weight of 632.71 g/mol. Its IUPAC name is (7S,12S)-7-[(4-hydroxyphenyl)methyl]-N-[2-(2-methoxy-4-methylphenoxy)ethyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide.
| Compound Name | (7S,12S)-7-[(4-hydroxyphenyl)methyl]-N-[2-(2-methoxy-4-methylphenoxy)ethyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
|---|---|
| PubChem CID | 133076388 |
| Molecular Formula | C34H40N4O8 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | (7S,12S)-7-[(4-hydroxyphenyl)methyl]-N-[2-(2-methoxy-4-methylphenoxy)ethyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
| SMILES | COc1cc(C)ccc1OCCNC(=O)[C@@H]1CCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N(C)CCOc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C34H40N4O8/c1-22-8-14-29(30(20-22)44-3)45-18-16-35-33(42)26-13-15-31(40)36-27(21-23-9-11-24(39)12-10-23)34(43)38(2)17-19-46-28-7-5-4-6-25(28)32(41)37-26/h4-12,14,20,26-27,39H,13,15-19,21H2,1-3H3,(H,35,42)(H,36,40)(H,37,41)/t26-,27-/m0/s1 |
| InChIKey | FCAIYMNMSJJUOX-SVBPBHIXSA-N |
| XLogP | 2.36 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|