C34H48N4O7 — CID 133074791
(4R,7R,11S)-N-[2-(2-methoxy-4-methylphenoxy)ethyl]-5-methyl-4,7-bis(2-methylpropyl)-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133074791) has the molecular formula C34H48N4O7 and a molecular weight of 624.78 g/mol. Its IUPAC name is (4R,7R,11S)-N-[2-(2-methoxy-4-methylphenoxy)ethyl]-5-methyl-4,7-bis(2-methylpropyl)-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (4R,7R,11S)-N-[2-(2-methoxy-4-methylphenoxy)ethyl]-5-methyl-4,7-bis(2-methylpropyl)-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133074791 |
| Molecular Formula | C34H48N4O7 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | (4R,7R,11S)-N-[2-(2-methoxy-4-methylphenoxy)ethyl]-5-methyl-4,7-bis(2-methylpropyl)-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | COc1cc(C)ccc1OCCNC(=O)[C@@H]1CC(=O)N[C@H](CC(C)C)C(=O)N(C)[C@H](CC(C)C)COc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C34H48N4O7/c1-21(2)16-24-20-45-28-11-9-8-10-25(28)32(40)37-26(19-31(39)36-27(17-22(3)4)34(42)38(24)6)33(41)35-14-15-44-29-13-12-23(5)18-30(29)43-7/h8-13,18,21-22,24,26-27H,14-17,19-20H2,1-7H3,(H,35,41)(H,36,39)(H,37,40)/t24-,26+,27-/m1/s1 |
| InChIKey | VZTVSRUEQIOWLH-FXVJXKIMSA-N |
| XLogP | 3.48 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|