C33H45ClN4O6 — CID 133074574
(4R,7R,11S)-N-[2-(4-chloro-3-methylphenoxy)ethyl]-5-methyl-4,7-bis(2-methylpropyl)-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133074574) has the molecular formula C33H45ClN4O6 and a molecular weight of 629.20 g/mol. Its IUPAC name is (4R,7R,11S)-N-[2-(4-chloro-3-methylphenoxy)ethyl]-5-methyl-4,7-bis(2-methylpropyl)-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (4R,7R,11S)-N-[2-(4-chloro-3-methylphenoxy)ethyl]-5-methyl-4,7-bis(2-methylpropyl)-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133074574 |
| Molecular Formula | C33H45ClN4O6 |
| Molecular Weight | 629.20 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | (4R,7R,11S)-N-[2-(4-chloro-3-methylphenoxy)ethyl]-5-methyl-4,7-bis(2-methylpropyl)-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | Cc1cc(OCCNC(=O)[C@@H]2CC(=O)N[C@H](CC(C)C)C(=O)N(C)[C@H](CC(C)C)COc3ccccc3C(=O)N2)ccc1Cl |
| InChI | InChI=1S/C33H45ClN4O6/c1-20(2)15-23-19-44-29-10-8-7-9-25(29)31(40)37-27(18-30(39)36-28(16-21(3)4)33(42)38(23)6)32(41)35-13-14-43-24-11-12-26(34)22(5)17-24/h7-12,17,20-21,23,27-28H,13-16,18-19H2,1-6H3,(H,35,41)(H,36,39)(H,37,40)/t23-,27+,28-/m1/s1 |
| InChIKey | CVJKIOCOYWNBHN-KEKPKEOLSA-N |
| XLogP | 4.13 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|