C33H44N4O6 — CID 133074634
(4S,10R,14S)-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]-9,12,16-trioxo-10-propan-2-yl-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide (PubChem CID 133074634) has the molecular formula C33H44N4O6 and a molecular weight of 592.74 g/mol. Its IUPAC name is (4S,10R,14S)-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]-9,12,16-trioxo-10-propan-2-yl-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide.
| Compound Name | (4S,10R,14S)-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]-9,12,16-trioxo-10-propan-2-yl-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide |
|---|---|
| PubChem CID | 133074634 |
| Molecular Formula | C33H44N4O6 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | (4S,10R,14S)-N-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]-9,12,16-trioxo-10-propan-2-yl-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide |
| SMILES | Cc1ccc(C(C)C)c(OCCNC(=O)[C@@H]2CC(=O)N[C@H](C(C)C)C(=O)N3CCC[C@H]3COc3ccccc3C(=O)N2)c1 |
| InChI | InChI=1S/C33H44N4O6/c1-20(2)24-13-12-22(5)17-28(24)42-16-14-34-32(40)26-18-29(38)36-30(21(3)4)33(41)37-15-8-9-23(37)19-43-27-11-7-6-10-25(27)31(39)35-26/h6-7,10-13,17,20-21,23,26,30H,8-9,14-16,18-19H2,1-5H3,(H,34,40)(H,35,39)(H,36,38)/t23-,26-,30+/m0/s1 |
| InChIKey | WVQYXUFQWPYDCX-HXZNTOGKSA-N |
| XLogP | 3.33 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|