C26H37N5O7 — CID 133074290
(4R,10S,14S)-10-(hydroxymethyl)-N-(3-morpholin-4-ylpropyl)-9,12,16-trioxo-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide (PubChem CID 133074290) has the molecular formula C26H37N5O7 and a molecular weight of 531.61 g/mol. Its IUPAC name is (4R,10S,14S)-10-(hydroxymethyl)-N-(3-morpholin-4-ylpropyl)-9,12,16-trioxo-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide.
| Compound Name | (4R,10S,14S)-10-(hydroxymethyl)-N-(3-morpholin-4-ylpropyl)-9,12,16-trioxo-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide |
|---|---|
| PubChem CID | 133074290 |
| Molecular Formula | C26H37N5O7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | (4R,10S,14S)-10-(hydroxymethyl)-N-(3-morpholin-4-ylpropyl)-9,12,16-trioxo-2-oxa-8,11,15-triazatricyclo[15.4.0.04,8]henicosa-1(21),17,19-triene-14-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)NCCCN2CCOCC2)NC(=O)c2ccccc2OC[C@H]2CCCN2C(=O)[C@H](CO)N1 |
| InChI | InChI=1S/C26H37N5O7/c32-16-21-26(36)31-10-3-5-18(31)17-38-22-7-2-1-6-19(22)24(34)29-20(15-23(33)28-21)25(35)27-8-4-9-30-11-13-37-14-12-30/h1-2,6-7,18,20-21,32H,3-5,8-17H2,(H,27,35)(H,28,33)(H,29,34)/t18-,20+,21+/m1/s1 |
| InChIKey | JYPQPGHEWGENFU-GIVPXCGWSA-N |
| XLogP | -1.13 |
| TPSA | 149.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|