C28H36N4O8 — CID 133078743
(7S,11S)-N-[3-(3,4-dimethoxyphenyl)propyl]-7-(hydroxymethyl)-5-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133078743) has the molecular formula C28H36N4O8 and a molecular weight of 556.62 g/mol. Its IUPAC name is (7S,11S)-N-[3-(3,4-dimethoxyphenyl)propyl]-7-(hydroxymethyl)-5-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-N-[3-(3,4-dimethoxyphenyl)propyl]-7-(hydroxymethyl)-5-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133078743 |
| Molecular Formula | C28H36N4O8 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | (7S,11S)-N-[3-(3,4-dimethoxyphenyl)propyl]-7-(hydroxymethyl)-5-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)[C@@H]2CC(=O)N[C@@H](CO)C(=O)N(C)CCOc3ccccc3C(=O)N2)cc1OC |
| InChI | InChI=1S/C28H36N4O8/c1-32-13-14-40-22-9-5-4-8-19(22)26(35)31-20(16-25(34)30-21(17-33)28(32)37)27(36)29-12-6-7-18-10-11-23(38-2)24(15-18)39-3/h4-5,8-11,15,20-21,33H,6-7,12-14,16-17H2,1-3H3,(H,29,36)(H,30,34)(H,31,35)/t20-,21-/m0/s1 |
| InChIKey | UMAINSIAQMMNRO-SFTDATJTSA-N |
| XLogP | 0.27 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|