C33H46N4O7 — CID 133074824
(4R,7R,11S)-N-[3-(3,4-dimethoxyphenyl)propyl]-4-(2-methylpropyl)-6,9,13-trioxo-7-propan-2-yl-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133074824) has the molecular formula C33H46N4O7 and a molecular weight of 610.75 g/mol. Its IUPAC name is (4R,7R,11S)-N-[3-(3,4-dimethoxyphenyl)propyl]-4-(2-methylpropyl)-6,9,13-trioxo-7-propan-2-yl-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (4R,7R,11S)-N-[3-(3,4-dimethoxyphenyl)propyl]-4-(2-methylpropyl)-6,9,13-trioxo-7-propan-2-yl-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133074824 |
| Molecular Formula | C33H46N4O7 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | (4R,7R,11S)-N-[3-(3,4-dimethoxyphenyl)propyl]-4-(2-methylpropyl)-6,9,13-trioxo-7-propan-2-yl-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)[C@@H]2CC(=O)N[C@H](C(C)C)C(=O)N[C@H](CC(C)C)COc3ccccc3C(=O)N2)cc1OC |
| InChI | InChI=1S/C33H46N4O7/c1-20(2)16-23-19-44-26-12-8-7-11-24(26)31(39)36-25(18-29(38)37-30(21(3)4)33(41)35-23)32(40)34-15-9-10-22-13-14-27(42-5)28(17-22)43-6/h7-8,11-14,17,20-21,23,25,30H,9-10,15-16,18-19H2,1-6H3,(H,34,40)(H,35,41)(H,36,39)(H,37,38)/t23-,25+,30-/m1/s1 |
| InChIKey | GYQBDZMOSAWCIB-FWVWFNHBSA-N |
| XLogP | 3.01 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|