C36H44N4O7 — CID 133078788
(4R,11S)-4-benzyl-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]-7,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133078788) has the molecular formula C36H44N4O7 and a molecular weight of 644.77 g/mol. Its IUPAC name is (4R,11S)-4-benzyl-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]-7,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (4R,11S)-4-benzyl-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]-7,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133078788 |
| Molecular Formula | C36H44N4O7 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.32 |
| IUPAC Name | (4R,11S)-4-benzyl-N-[3-(4-ethoxy-3-methoxyphenyl)propyl]-7,7-dimethyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | CCOc1ccc(CCCNC(=O)[C@@H]2CC(=O)NC(C)(C)C(=O)N[C@H](Cc3ccccc3)COc3ccccc3C(=O)N2)cc1OC |
| InChI | InChI=1S/C36H44N4O7/c1-5-46-30-18-17-25(21-31(30)45-4)14-11-19-37-34(43)28-22-32(41)40-36(2,3)35(44)38-26(20-24-12-7-6-8-13-24)23-47-29-16-10-9-15-27(29)33(42)39-28/h6-10,12-13,15-18,21,26,28H,5,11,14,19-20,22-23H2,1-4H3,(H,37,43)(H,38,44)(H,39,42)(H,40,41)/t26-,28+/m1/s1 |
| InChIKey | SPMYESGYMUHGFT-IAPPQJPRSA-N |
| XLogP | 3.35 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|