C32H36N4O6 — CID 133076505
(7S,11S)-7-benzyl-N-[3-(3-methoxyphenyl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133076505) has the molecular formula C32H36N4O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is (7S,11S)-7-benzyl-N-[3-(3-methoxyphenyl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-7-benzyl-N-[3-(3-methoxyphenyl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133076505 |
| Molecular Formula | C32H36N4O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (7S,11S)-7-benzyl-N-[3-(3-methoxyphenyl)propyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | COc1cccc(CCCNC(=O)[C@@H]2CC(=O)N[C@@H](Cc3ccccc3)C(=O)NCCOc3ccccc3C(=O)N2)c1 |
| InChI | InChI=1S/C32H36N4O6/c1-41-24-13-7-11-22(19-24)12-8-16-33-32(40)27-21-29(37)35-26(20-23-9-3-2-4-10-23)31(39)34-17-18-42-28-15-6-5-14-25(28)30(38)36-27/h2-7,9-11,13-15,19,26-27H,8,12,16-18,20-21H2,1H3,(H,33,40)(H,34,39)(H,35,37)(H,36,38)/t26-,27-/m0/s1 |
| InChIKey | VSWIRLIFAFXLJP-SVBPBHIXSA-N |
| XLogP | 2.17 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|