C23H25N3O6 — CID 110062470
(7R,12S)-7-benzyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxylic acid (PubChem CID 110062470) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is (7R,12S)-7-benzyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxylic acid.
| Compound Name | (7R,12S)-7-benzyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxylic acid |
|---|---|
| PubChem CID | 110062470 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (7R,12S)-7-benzyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxylic acid |
| SMILES | O=C1CC[C@@H](C(=O)O)NC(=O)c2ccccc2OCCNC(=O)[C@@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C23H25N3O6/c27-20-11-10-17(23(30)31)26-21(28)16-8-4-5-9-19(16)32-13-12-24-22(29)18(25-20)14-15-6-2-1-3-7-15/h1-9,17-18H,10-14H2,(H,24,29)(H,25,27)(H,26,28)(H,30,31)/t17-,18+/m0/s1 |
| InChIKey | SSWQIPHTAGPOAI-ZWKOTPCHSA-N |
| XLogP | 0.89 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |