C19H25N3O7 — CID 133080286
(8S,13S)-8-[(1R)-1-hydroxyethyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxylic acid (PubChem CID 133080286) has the molecular formula C19H25N3O7 and a molecular weight of 407.42 g/mol. Its IUPAC name is (8S,13S)-8-[(1R)-1-hydroxyethyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxylic acid.
| Compound Name | (8S,13S)-8-[(1R)-1-hydroxyethyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxylic acid |
|---|---|
| PubChem CID | 133080286 |
| Molecular Formula | C19H25N3O7 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (8S,13S)-8-[(1R)-1-hydroxyethyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxylic acid |
| SMILES | C[C@@H](O)[C@@H]1NC(=O)CC[C@@H](C(=O)O)NC(=O)c2ccccc2OCCCNC1=O |
| InChI | InChI=1S/C19H25N3O7/c1-11(23)16-18(26)20-9-4-10-29-14-6-3-2-5-12(14)17(25)21-13(19(27)28)7-8-15(24)22-16/h2-3,5-6,11,13,16,23H,4,7-10H2,1H3,(H,20,26)(H,21,25)(H,22,24)(H,27,28)/t11-,13+,16+/m1/s1 |
| InChIKey | GTVBYRBTDNBYCD-FFSVYQOJSA-N |
| XLogP | -0.59 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |