C31H41N5O7 — CID 133077619
(8S,13S)-8-[(1R)-1-hydroxyethyl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide (PubChem CID 133077619) has the molecular formula C31H41N5O7 and a molecular weight of 595.70 g/mol. Its IUPAC name is (8S,13S)-8-[(1R)-1-hydroxyethyl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide.
| Compound Name | (8S,13S)-8-[(1R)-1-hydroxyethyl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide |
|---|---|
| PubChem CID | 133077619 |
| Molecular Formula | C31H41N5O7 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | (8S,13S)-8-[(1R)-1-hydroxyethyl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide |
| SMILES | C[C@@H](O)[C@@H]1NC(=O)CC[C@@H](C(=O)NCc2cccc(CN3CCOCC3)c2)NC(=O)c2ccccc2OCCCNC1=O |
| InChI | InChI=1S/C31H41N5O7/c1-21(37)28-31(41)32-12-5-15-43-26-9-3-2-8-24(26)29(39)34-25(10-11-27(38)35-28)30(40)33-19-22-6-4-7-23(18-22)20-36-13-16-42-17-14-36/h2-4,6-9,18,21,25,28,37H,5,10-17,19-20H2,1H3,(H,32,41)(H,33,40)(H,34,39)(H,35,38)/t21-,25+,28+/m1/s1 |
| InChIKey | JJPVZVLJJNZTBF-ZNFSXRAMSA-N |
| XLogP | 0.48 |
| TPSA | 158.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |