C28H35N5O7 — CID 133080116
(7S,11S)-7-(hydroxymethyl)-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133080116) has the molecular formula C28H35N5O7 and a molecular weight of 553.62 g/mol. Its IUPAC name is (7S,11S)-7-(hydroxymethyl)-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-7-(hydroxymethyl)-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133080116 |
| Molecular Formula | C28H35N5O7 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | (7S,11S)-7-(hydroxymethyl)-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)NCc2cccc(CN3CCOCC3)c2)NC(=O)c2ccccc2OCCNC(=O)[C@H](CO)N1 |
| InChI | InChI=1S/C28H35N5O7/c34-18-23-28(38)29-8-11-40-24-7-2-1-6-21(24)26(36)32-22(15-25(35)31-23)27(37)30-16-19-4-3-5-20(14-19)17-33-9-12-39-13-10-33/h1-7,14,22-23,34H,8-13,15-18H2,(H,29,38)(H,30,37)(H,31,35)(H,32,36)/t22-,23-/m0/s1 |
| InChIKey | UZCFILSDOVBIOL-GOTSBHOMSA-N |
| XLogP | -0.69 |
| TPSA | 158.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |