C31H41N5O6 — CID 133075388
(7S,11S)-7-[(2S)-butan-2-yl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133075388) has the molecular formula C31H41N5O6 and a molecular weight of 579.70 g/mol. Its IUPAC name is (7S,11S)-7-[(2S)-butan-2-yl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-7-[(2S)-butan-2-yl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133075388 |
| Molecular Formula | C31H41N5O6 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | (7S,11S)-7-[(2S)-butan-2-yl]-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)C[C@@H](C(=O)NCc2cccc(CN3CCOCC3)c2)NC(=O)c2ccccc2OCCNC1=O |
| InChI | InChI=1S/C31H41N5O6/c1-3-21(2)28-31(40)32-11-14-42-26-10-5-4-9-24(26)29(38)34-25(18-27(37)35-28)30(39)33-19-22-7-6-8-23(17-22)20-36-12-15-41-16-13-36/h4-10,17,21,25,28H,3,11-16,18-20H2,1-2H3,(H,32,40)(H,33,39)(H,34,38)(H,35,37)/t21-,25-,28-/m0/s1 |
| InChIKey | CREVQEVXCZHWKJ-QLADTWODSA-N |
| XLogP | 1.36 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |