C30H41N5O5 — CID 133076051
(8S,13S)-8-benzyl-N-[4-(dimethylamino)butyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide (PubChem CID 133076051) has the molecular formula C30H41N5O5 and a molecular weight of 551.69 g/mol. Its IUPAC name is (8S,13S)-8-benzyl-N-[4-(dimethylamino)butyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide.
| Compound Name | (8S,13S)-8-benzyl-N-[4-(dimethylamino)butyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide |
|---|---|
| PubChem CID | 133076051 |
| Molecular Formula | C30H41N5O5 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | (8S,13S)-8-benzyl-N-[4-(dimethylamino)butyl]-7,10,15-trioxo-2-oxa-6,9,14-triazabicyclo[14.4.0]icosa-1(20),16,18-triene-13-carboxamide |
| SMILES | CN(C)CCCCNC(=O)[C@@H]1CCC(=O)N[C@@H](Cc2ccccc2)C(=O)NCCCOc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C30H41N5O5/c1-35(2)19-9-8-17-31-29(38)24-15-16-27(36)33-25(21-22-11-4-3-5-12-22)30(39)32-18-10-20-40-26-14-7-6-13-23(26)28(37)34-24/h3-7,11-14,24-25H,8-10,15-21H2,1-2H3,(H,31,38)(H,32,39)(H,33,36)(H,34,37)/t24-,25-/m0/s1 |
| InChIKey | KQJXXVPLEWKQRP-DQEYMECFSA-N |
| XLogP | 1.65 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|