C32H39N7O6 — CID 133072812
(8S,11S,15S)-8-benzyl-N-(3-imidazol-1-ylpropyl)-11-methyl-7,10,13,17-tetraoxo-2-oxa-6,9,12,16-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-15-carboxamide (PubChem CID 133072812) has the molecular formula C32H39N7O6 and a molecular weight of 617.71 g/mol. Its IUPAC name is (8S,11S,15S)-8-benzyl-N-(3-imidazol-1-ylpropyl)-11-methyl-7,10,13,17-tetraoxo-2-oxa-6,9,12,16-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-15-carboxamide.
| Compound Name | (8S,11S,15S)-8-benzyl-N-(3-imidazol-1-ylpropyl)-11-methyl-7,10,13,17-tetraoxo-2-oxa-6,9,12,16-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-15-carboxamide |
|---|---|
| PubChem CID | 133072812 |
| Molecular Formula | C32H39N7O6 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | (8S,11S,15S)-8-benzyl-N-(3-imidazol-1-ylpropyl)-11-methyl-7,10,13,17-tetraoxo-2-oxa-6,9,12,16-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-15-carboxamide |
| SMILES | C[C@@H]1NC(=O)C[C@@H](C(=O)NCCCn2ccnc2)NC(=O)c2ccccc2OCCCNC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C32H39N7O6/c1-22-29(41)37-25(19-23-9-3-2-4-10-23)31(43)35-14-8-18-45-27-12-6-5-11-24(27)30(42)38-26(20-28(40)36-22)32(44)34-13-7-16-39-17-15-33-21-39/h2-6,9-12,15,17,21-22,25-26H,7-8,13-14,16,18-20H2,1H3,(H,34,44)(H,35,43)(H,36,40)(H,37,41)(H,38,42)/t22-,25-,26-/m0/s1 |
| InChIKey | LRISLWGDIVHAPD-HRNNMHKYSA-N |
| XLogP | 0.71 |
| TPSA | 172.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|