C37H45N5O7 — CID 133077124
(8S,15S)-8-benzyl-N-[2-(2,4-dimethylphenoxy)ethyl]-11,11-dimethyl-7,10,13,17-tetraoxo-2-oxa-6,9,12,16-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-15-carboxamide (PubChem CID 133077124) has the molecular formula C37H45N5O7 and a molecular weight of 671.80 g/mol. Its IUPAC name is (8S,15S)-8-benzyl-N-[2-(2,4-dimethylphenoxy)ethyl]-11,11-dimethyl-7,10,13,17-tetraoxo-2-oxa-6,9,12,16-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-15-carboxamide.
| Compound Name | (8S,15S)-8-benzyl-N-[2-(2,4-dimethylphenoxy)ethyl]-11,11-dimethyl-7,10,13,17-tetraoxo-2-oxa-6,9,12,16-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-15-carboxamide |
|---|---|
| PubChem CID | 133077124 |
| Molecular Formula | C37H45N5O7 |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | (8S,15S)-8-benzyl-N-[2-(2,4-dimethylphenoxy)ethyl]-11,11-dimethyl-7,10,13,17-tetraoxo-2-oxa-6,9,12,16-tetrazabicyclo[16.4.0]docosa-1(22),18,20-triene-15-carboxamide |
| SMILES | Cc1ccc(OCCNC(=O)[C@@H]2CC(=O)NC(C)(C)C(=O)N[C@@H](Cc3ccccc3)C(=O)NCCCOc3ccccc3C(=O)N2)c(C)c1 |
| InChI | InChI=1S/C37H45N5O7/c1-24-15-16-30(25(2)21-24)49-20-18-39-35(46)29-23-32(43)42-37(3,4)36(47)41-28(22-26-11-6-5-7-12-26)34(45)38-17-10-19-48-31-14-9-8-13-27(31)33(44)40-29/h5-9,11-16,21,28-29H,10,17-20,22-23H2,1-4H3,(H,38,45)(H,39,46)(H,40,44)(H,41,47)(H,42,43)/t28-,29-/m0/s1 |
| InChIKey | FQHVGTVLVWMEDU-VMPREFPWSA-N |
| XLogP | 2.51 |
| TPSA | 163.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|