C30H31ClN4O7 — CID 133078801
(7S,11S)-N-[2-(4-chlorophenoxy)ethyl]-7-[(4-hydroxyphenyl)methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133078801) has the molecular formula C30H31ClN4O7 and a molecular weight of 595.05 g/mol. Its IUPAC name is (7S,11S)-N-[2-(4-chlorophenoxy)ethyl]-7-[(4-hydroxyphenyl)methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (7S,11S)-N-[2-(4-chlorophenoxy)ethyl]-7-[(4-hydroxyphenyl)methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133078801 |
| Molecular Formula | C30H31ClN4O7 |
| Molecular Weight | 595.05 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | (7S,11S)-N-[2-(4-chlorophenoxy)ethyl]-7-[(4-hydroxyphenyl)methyl]-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)NCCOc2ccc(Cl)cc2)NC(=O)c2ccccc2OCCNC(=O)[C@H](Cc2ccc(O)cc2)N1 |
| InChI | InChI=1S/C30H31ClN4O7/c31-20-7-11-22(12-8-20)41-15-13-32-30(40)25-18-27(37)34-24(17-19-5-9-21(36)10-6-19)29(39)33-14-16-42-26-4-2-1-3-23(26)28(38)35-25/h1-12,24-25,36H,13-18H2,(H,32,40)(H,33,39)(H,34,37)(H,35,38)/t24-,25-/m0/s1 |
| InChIKey | XHZAQIJXDKFRSM-DQEYMECFSA-N |
| XLogP | 1.97 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.05 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|