C27H32N4O6 — CID 133076033
(4R,7S,11S)-N-(cyclopropylmethyl)-7-[(4-hydroxyphenyl)methyl]-4-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide (PubChem CID 133076033) has the molecular formula C27H32N4O6 and a molecular weight of 508.58 g/mol. Its IUPAC name is (4R,7S,11S)-N-(cyclopropylmethyl)-7-[(4-hydroxyphenyl)methyl]-4-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide.
| Compound Name | (4R,7S,11S)-N-(cyclopropylmethyl)-7-[(4-hydroxyphenyl)methyl]-4-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
|---|---|
| PubChem CID | 133076033 |
| Molecular Formula | C27H32N4O6 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (4R,7S,11S)-N-(cyclopropylmethyl)-7-[(4-hydroxyphenyl)methyl]-4-methyl-6,9,13-trioxo-2-oxa-5,8,12-triazabicyclo[12.4.0]octadeca-1(18),14,16-triene-11-carboxamide |
| SMILES | C[C@@H]1COc2ccccc2C(=O)N[C@H](C(=O)NCC2CC2)CC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N1 |
| InChI | InChI=1S/C27H32N4O6/c1-16-15-37-23-5-3-2-4-20(23)25(34)31-22(26(35)28-14-18-6-7-18)13-24(33)30-21(27(36)29-16)12-17-8-10-19(32)11-9-17/h2-5,8-11,16,18,21-22,32H,6-7,12-15H2,1H3,(H,28,35)(H,29,36)(H,30,33)(H,31,34)/t16-,21+,22+/m1/s1 |
| InChIKey | BZZLTAXTEFUCRS-XGRCMKMKSA-N |
| XLogP | 1.03 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |