C24H37N5O6 — CID 133074472
(7S,12S)-N-[3-(dimethylamino)propyl]-7-[(1R)-1-hydroxyethyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide (PubChem CID 133074472) has the molecular formula C24H37N5O6 and a molecular weight of 491.59 g/mol. Its IUPAC name is (7S,12S)-N-[3-(dimethylamino)propyl]-7-[(1R)-1-hydroxyethyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide.
| Compound Name | (7S,12S)-N-[3-(dimethylamino)propyl]-7-[(1R)-1-hydroxyethyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
|---|---|
| PubChem CID | 133074472 |
| Molecular Formula | C24H37N5O6 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (7S,12S)-N-[3-(dimethylamino)propyl]-7-[(1R)-1-hydroxyethyl]-5-methyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
| SMILES | C[C@@H](O)[C@@H]1NC(=O)CC[C@@H](C(=O)NCCCN(C)C)NC(=O)c2ccccc2OCCN(C)C1=O |
| InChI | InChI=1S/C24H37N5O6/c1-16(30)21-24(34)29(4)14-15-35-19-9-6-5-8-17(19)22(32)26-18(10-11-20(31)27-21)23(33)25-12-7-13-28(2)3/h5-6,8-9,16,18,21,30H,7,10-15H2,1-4H3,(H,25,33)(H,26,32)(H,27,31)/t16-,18+,21+/m1/s1 |
| InChIKey | MDAPBXPSCYLJLI-MMOPVJDHSA-N |
| XLogP | -0.65 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|