C35H41FN4O5 — CID 133074520
(4R,12S)-4-benzyl-N-[2-(4-fluorophenyl)-2-methylpropyl]-5,8-dimethyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide (PubChem CID 133074520) has the molecular formula C35H41FN4O5 and a molecular weight of 616.73 g/mol. Its IUPAC name is (4R,12S)-4-benzyl-N-[2-(4-fluorophenyl)-2-methylpropyl]-5,8-dimethyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide.
| Compound Name | (4R,12S)-4-benzyl-N-[2-(4-fluorophenyl)-2-methylpropyl]-5,8-dimethyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
|---|---|
| PubChem CID | 133074520 |
| Molecular Formula | C35H41FN4O5 |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | (4R,12S)-4-benzyl-N-[2-(4-fluorophenyl)-2-methylpropyl]-5,8-dimethyl-6,9,14-trioxo-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-12-carboxamide |
| SMILES | CN1CC(=O)N(C)[C@H](Cc2ccccc2)COc2ccccc2C(=O)N[C@H](C(=O)NCC(C)(C)c2ccc(F)cc2)CCC1=O |
| InChI | InChI=1S/C35H41FN4O5/c1-35(2,25-14-16-26(36)17-15-25)23-37-34(44)29-18-19-31(41)39(3)21-32(42)40(4)27(20-24-10-6-5-7-11-24)22-45-30-13-9-8-12-28(30)33(43)38-29/h5-17,27,29H,18-23H2,1-4H3,(H,37,44)(H,38,43)/t27-,29+/m1/s1 |
| InChIKey | IRRCZJOJZIPSRV-PXJZQJOASA-N |
| XLogP | 3.72 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |