C31H40N4O6 — CID 133074382
(4R,12S)-4-benzyl-12-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-5,8-dimethyl-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-6,9,14-trione (PubChem CID 133074382) has the molecular formula C31H40N4O6 and a molecular weight of 564.68 g/mol. Its IUPAC name is (4R,12S)-4-benzyl-12-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-5,8-dimethyl-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-6,9,14-trione.
| Compound Name | (4R,12S)-4-benzyl-12-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-5,8-dimethyl-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-6,9,14-trione |
|---|---|
| PubChem CID | 133074382 |
| Molecular Formula | C31H40N4O6 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | (4R,12S)-4-benzyl-12-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-5,8-dimethyl-2-oxa-5,8,13-triazabicyclo[13.4.0]nonadeca-1(19),15,17-triene-6,9,14-trione |
| SMILES | C[C@@H]1CN(C(=O)[C@@H]2CCC(=O)N(C)CC(=O)N(C)[C@H](Cc3ccccc3)COc3ccccc3C(=O)N2)C[C@H](C)O1 |
| InChI | InChI=1S/C31H40N4O6/c1-21-17-35(18-22(2)41-21)31(39)26-14-15-28(36)33(3)19-29(37)34(4)24(16-23-10-6-5-7-11-23)20-40-27-13-9-8-12-25(27)30(38)32-26/h5-13,21-22,24,26H,14-20H2,1-4H3,(H,32,38)/t21-,22+,24-,26+/m1/s1 |
| InChIKey | LXDDWFGSUBUKOG-APAYAGTCSA-N |
| XLogP | 2.12 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |