C36H40ClN5O7 — CID 133076054
(4S,11R,17R)-17-benzyl-N-[2-(4-chlorophenoxy)ethyl]-13-methyl-2,6,12,15-tetraoxo-19-oxa-3,7,13,16-tetrazatricyclo[18.4.0.07,11]tetracosa-1(24),20,22-triene-4-carboxamide (PubChem CID 133076054) has the molecular formula C36H40ClN5O7 and a molecular weight of 690.20 g/mol. Its IUPAC name is (4S,11R,17R)-17-benzyl-N-[2-(4-chlorophenoxy)ethyl]-13-methyl-2,6,12,15-tetraoxo-19-oxa-3,7,13,16-tetrazatricyclo[18.4.0.07,11]tetracosa-1(24),20,22-triene-4-carboxamide.
| Compound Name | (4S,11R,17R)-17-benzyl-N-[2-(4-chlorophenoxy)ethyl]-13-methyl-2,6,12,15-tetraoxo-19-oxa-3,7,13,16-tetrazatricyclo[18.4.0.07,11]tetracosa-1(24),20,22-triene-4-carboxamide |
|---|---|
| PubChem CID | 133076054 |
| Molecular Formula | C36H40ClN5O7 |
| Molecular Weight | 690.20 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | (4S,11R,17R)-17-benzyl-N-[2-(4-chlorophenoxy)ethyl]-13-methyl-2,6,12,15-tetraoxo-19-oxa-3,7,13,16-tetrazatricyclo[18.4.0.07,11]tetracosa-1(24),20,22-triene-4-carboxamide |
| SMILES | CN1CC(=O)N[C@H](Cc2ccccc2)COc2ccccc2C(=O)N[C@H](C(=O)NCCOc2ccc(Cl)cc2)CC(=O)N2CCC[C@@H]2C1=O |
| InChI | InChI=1S/C36H40ClN5O7/c1-41-22-32(43)39-26(20-24-8-3-2-4-9-24)23-49-31-12-6-5-10-28(31)34(45)40-29(21-33(44)42-18-7-11-30(42)36(41)47)35(46)38-17-19-48-27-15-13-25(37)14-16-27/h2-6,8-10,12-16,26,29-30H,7,11,17-23H2,1H3,(H,38,46)(H,39,43)(H,40,45)/t26-,29+,30-/m1/s1 |
| InChIKey | AYBJEPQLKNNHRR-JJZPZGAKSA-N |
| XLogP | 2.59 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|