C37H43N5O7 — CID 133075506
(4S,11R,17R)-17-benzyl-N-[2-(4-methoxyphenyl)ethyl]-13-methyl-2,6,12,15-tetraoxo-19-oxa-3,7,13,16-tetrazatricyclo[18.4.0.07,11]tetracosa-1(24),20,22-triene-4-carboxamide (PubChem CID 133075506) has the molecular formula C37H43N5O7 and a molecular weight of 669.78 g/mol. Its IUPAC name is (4S,11R,17R)-17-benzyl-N-[2-(4-methoxyphenyl)ethyl]-13-methyl-2,6,12,15-tetraoxo-19-oxa-3,7,13,16-tetrazatricyclo[18.4.0.07,11]tetracosa-1(24),20,22-triene-4-carboxamide.
| Compound Name | (4S,11R,17R)-17-benzyl-N-[2-(4-methoxyphenyl)ethyl]-13-methyl-2,6,12,15-tetraoxo-19-oxa-3,7,13,16-tetrazatricyclo[18.4.0.07,11]tetracosa-1(24),20,22-triene-4-carboxamide |
|---|---|
| PubChem CID | 133075506 |
| Molecular Formula | C37H43N5O7 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.32 |
| IUPAC Name | (4S,11R,17R)-17-benzyl-N-[2-(4-methoxyphenyl)ethyl]-13-methyl-2,6,12,15-tetraoxo-19-oxa-3,7,13,16-tetrazatricyclo[18.4.0.07,11]tetracosa-1(24),20,22-triene-4-carboxamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H]2CC(=O)N3CCC[C@@H]3C(=O)N(C)CC(=O)N[C@H](Cc3ccccc3)COc3ccccc3C(=O)N2)cc1 |
| InChI | InChI=1S/C37H43N5O7/c1-41-23-33(43)39-27(21-26-9-4-3-5-10-26)24-49-32-13-7-6-11-29(32)35(45)40-30(22-34(44)42-20-8-12-31(42)37(41)47)36(46)38-19-18-25-14-16-28(48-2)17-15-25/h3-7,9-11,13-17,27,30-31H,8,12,18-24H2,1-2H3,(H,38,46)(H,39,43)(H,40,45)/t27-,30+,31-/m1/s1 |
| InChIKey | NZFLOUSMPXTUDU-JMJMSVOMSA-N |
| XLogP | 2.11 |
| TPSA | 146.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |