C34H46N4O5 — CID 155998892
(11S,16S)-11-benzyl-N-cyclopentyl-9,12-dimethyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide (PubChem CID 155998892) has the molecular formula C34H46N4O5 and a molecular weight of 590.77 g/mol. Its IUPAC name is (11S,16S)-11-benzyl-N-cyclopentyl-9,12-dimethyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide.
| Compound Name | (11S,16S)-11-benzyl-N-cyclopentyl-9,12-dimethyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide |
|---|---|
| PubChem CID | 155998892 |
| Molecular Formula | C34H46N4O5 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | (11S,16S)-11-benzyl-N-cyclopentyl-9,12-dimethyl-10,13,18-trioxo-2-oxa-9,12,17-triazabicyclo[17.4.0]tricosa-1(23),19,21-triene-16-carboxamide |
| SMILES | CN1CCCCCCOc2ccccc2C(=O)N[C@H](C(=O)NC2CCCC2)CCC(=O)N(C)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C34H46N4O5/c1-37-22-12-3-4-13-23-43-30-19-11-10-18-27(30)32(40)36-28(33(41)35-26-16-8-9-17-26)20-21-31(39)38(2)29(34(37)42)24-25-14-6-5-7-15-25/h5-7,10-11,14-15,18-19,26,28-29H,3-4,8-9,12-13,16-17,20-24H2,1-2H3,(H,35,41)(H,36,40)/t28-,29-/m0/s1 |
| InChIKey | WRTKJOYDDKDYIR-VMPREFPWSA-N |
| XLogP | 4.10 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |