C30H38N2O6 — CID 145437809
2-cyclobutylidene-N-[(2,4-dimethoxyphenyl)methyl]-2-(13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl)acetamide (PubChem CID 145437809) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is 2-cyclobutylidene-N-[(2,4-dimethoxyphenyl)methyl]-2-(13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl)acetamide.
| Compound Name | 2-cyclobutylidene-N-[(2,4-dimethoxyphenyl)methyl]-2-(13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl)acetamide |
|---|---|
| PubChem CID | 145437809 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 2-cyclobutylidene-N-[(2,4-dimethoxyphenyl)methyl]-2-(13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),14,16-trien-11-yl)acetamide |
| SMILES | COc1ccc(CNC(=O)C(=C2CCC2)C2CCCCOCCOCc3ccccc3C(=O)N2)c(OC)c1 |
| InChI | InChI=1S/C30H38N2O6/c1-35-24-14-13-22(27(18-24)36-2)19-31-30(34)28(21-9-7-10-21)26-12-5-6-15-37-16-17-38-20-23-8-3-4-11-25(23)29(33)32-26/h3-4,8,11,13-14,18,26H,5-7,9-10,12,15-17,19-20H2,1-2H3,(H,31,34)(H,32,33) |
| InChIKey | GUVKMGGVEQZNGZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|