C25H27ClN2O5 — CID 145437948
N-[2-(4-chlorophenyl)ethyl]-2-oxo-2-[(8Z)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetamide (PubChem CID 145437948) has the molecular formula C25H27ClN2O5 and a molecular weight of 470.95 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-oxo-2-[(8Z)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-oxo-2-[(8Z)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetamide |
|---|---|
| PubChem CID | 145437948 |
| Molecular Formula | C25H27ClN2O5 |
| Molecular Weight | 470.95 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-oxo-2-[(8Z)-13-oxo-3,6-dioxa-12-azabicyclo[12.4.0]octadeca-1(18),8,14,16-tetraen-11-yl]acetamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)C(=O)C1C/C=C\COCCOCc2ccccc2C(=O)N1 |
| InChI | InChI=1S/C25H27ClN2O5/c26-20-10-8-18(9-11-20)12-13-27-25(31)23(29)22-7-3-4-14-32-15-16-33-17-19-5-1-2-6-21(19)24(30)28-22/h1-6,8-11,22H,7,12-17H2,(H,27,31)(H,28,30)/b4-3- |
| InChIKey | PTGDPBPBXFDQFW-ARJAWSKDSA-N |
| XLogP | 2.86 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.95 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|